1126 lines
28 KiB
1126 lines
28 KiB
/*==LICENSE==* |
|
|
|
CyanWorlds.com Engine - MMOG client, server and tools |
|
Copyright (C) 2011 Cyan Worlds, Inc. |
|
|
|
This program is free software: you can redistribute it and/or modify |
|
it under the terms of the GNU General Public License as published by |
|
the Free Software Foundation, either version 3 of the License, or |
|
(at your option) any later version. |
|
|
|
This program is distributed in the hope that it will be useful, |
|
but WITHOUT ANY WARRANTY; without even the implied warranty of |
|
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the |
|
GNU General Public License for more details. |
|
|
|
You should have received a copy of the GNU General Public License |
|
along with this program. If not, see <http://www.gnu.org/licenses/>. |
|
|
|
Additional permissions under GNU GPL version 3 section 7 |
|
|
|
If you modify this Program, or any covered work, by linking or |
|
combining it with any of RAD Game Tools Bink SDK, Autodesk 3ds Max SDK, |
|
NVIDIA PhysX SDK, Microsoft DirectX SDK, OpenSSL library, Independent |
|
JPEG Group JPEG library, Microsoft Windows Media SDK, or Apple QuickTime SDK |
|
(or a modified version of those libraries), |
|
containing parts covered by the terms of the Bink SDK EULA, 3ds Max EULA, |
|
PhysX SDK EULA, DirectX SDK EULA, OpenSSL and SSLeay licenses, IJG |
|
JPEG Library README, Windows Media SDK EULA, or QuickTime SDK EULA, the |
|
licensors of this Program grant you additional |
|
permission to convey the resulting work. Corresponding Source for a |
|
non-source form of such a combination shall include the source code for |
|
the parts of OpenSSL and IJG JPEG Library used as well as that of the covered |
|
work. |
|
|
|
You can contact Cyan Worlds, Inc. by email legal@cyan.com |
|
or by snail mail at: |
|
Cyan Worlds, Inc. |
|
14617 N Newport Hwy |
|
Mead, WA 99021 |
|
|
|
*==LICENSE==*/ |
|
#include "plConfigInfo.h" |
|
|
|
#include "HeadSpin.h" |
|
#include <fstream> |
|
#include <algorithm> |
|
#include <sstream> |
|
|
|
const plString& plConfigInfo::GlobalSection() |
|
{ |
|
static plString section("global"); |
|
return section; |
|
} |
|
|
|
plConfigInfo::plConfigInfo() |
|
{ |
|
} |
|
|
|
plConfigInfo::plConfigInfo(const plConfigInfo & src) |
|
: fSections(src.fSections) |
|
{ |
|
} |
|
|
|
plConfigInfo & plConfigInfo::operator =(const plConfigInfo & src) |
|
{ |
|
fSections = src.fSections; |
|
return *this; |
|
} |
|
|
|
void plConfigInfo::Clear() |
|
{ |
|
fSections.clear(); |
|
} |
|
|
|
void plConfigInfo::RemoveSection(const plString & section) |
|
{ |
|
fSections.erase(section); |
|
} |
|
|
|
void plConfigInfo::RemoveKey(const plString & section, const plString & key) |
|
{ |
|
Sections::iterator si = fSections.find(section); |
|
if (si != fSections.end()) |
|
fSections[section].RemoveKey(key); |
|
} |
|
|
|
bool plConfigInfo::HasSection(const plString & section) const |
|
{ |
|
return fSections.find(section)!=fSections.end(); |
|
} |
|
|
|
bool plConfigInfo::HasKey(const plString & section, const plString & key) |
|
{ |
|
Sections::iterator si = fSections.find(section); |
|
if (si == fSections.end()) |
|
return false; |
|
return (si->second.HasKey(key)); |
|
} |
|
|
|
bool plConfigInfo::HasKeyAny(const plString & key) |
|
{ |
|
for (Sections::iterator si=fSections.begin(); si!=fSections.end(); ++si) |
|
{ |
|
if (si->second.HasKey(key)) |
|
return true; |
|
} |
|
return false; |
|
} |
|
|
|
bool plConfigInfo::HasKeyIn(const plString & key, const char * section1, ...) |
|
{ |
|
const char * section = section1; |
|
va_list va; |
|
va_start(va,section1); |
|
std::vector<plString> sections; |
|
while (section) |
|
{ |
|
sections.push_back( section ); |
|
section = va_arg(va,const char *); |
|
} |
|
va_end(va); |
|
return HasKeyIn( key, sections ); |
|
} |
|
|
|
bool plConfigInfo::HasKeyIn(const plString & key, const std::vector<plString> & sections ) |
|
{ |
|
for ( int i=0; i<sections.size(); i++ ) |
|
{ |
|
if (HasSection(sections[i])) |
|
{ |
|
if (fSections[sections[i]].HasKey(key)) |
|
return true; |
|
} |
|
} |
|
return false; |
|
} |
|
|
|
bool plConfigInfo::KeyHasValue(const plString & section, const plString & key, const plString & value) |
|
{ |
|
Sections::iterator si = fSections.find(section); |
|
if (si == fSections.end()) |
|
return false; |
|
return si->second.KeyHasValue(key,value); |
|
} |
|
|
|
bool plConfigInfo::KeyHasValue(const plString & section, const plString & key, int value) |
|
{ |
|
Sections::iterator si = fSections.find(section); |
|
if (si == fSections.end()) |
|
return false; |
|
return si->second.KeyHasValue(key,value); |
|
} |
|
|
|
bool plConfigInfo::KeyHasValue(const plString & section, const plString & key, double value) |
|
{ |
|
Sections::iterator si = fSections.find(section); |
|
if (si == fSections.end()) |
|
return false; |
|
return si->second.KeyHasValue(key,value); |
|
} |
|
|
|
bool plConfigInfo::AddValue(const plString & section, const plString & key, const plString & value, KAddValueMode mode) |
|
{ |
|
return fSections[section].AddValue(key,value,mode); |
|
} |
|
|
|
bool plConfigInfo::AddValue(const plString & section, const plString & key, int value, KAddValueMode mode) |
|
{ |
|
return fSections[section].AddValue(key,value,mode); |
|
} |
|
|
|
bool plConfigInfo::AddValue(const plString & section, const plString & key, double value, KAddValueMode mode) |
|
{ |
|
return fSections[section].AddValue(key,value,mode); |
|
} |
|
|
|
bool plConfigInfo::AddValues(const plString & section, const plString & key, const std::vector<plString> & values, KAddValueMode mode) |
|
{ |
|
return fSections[section].AddValues(key,values); |
|
} |
|
|
|
plKeysAndValues plConfigInfo::GetSection(const plString & section, bool & found) |
|
{ |
|
found = HasSection(section); |
|
if (found) |
|
return fSections[section]; |
|
else |
|
return plKeysAndValues(); // empty |
|
} |
|
|
|
std::vector<plString> plConfigInfo::GetSectionNames() |
|
{ |
|
std::vector<plString> results; |
|
for (Sections::const_iterator ii=fSections.begin(); ii!=fSections.end(); ++ii) |
|
results.push_back(ii->first); |
|
return results; |
|
} |
|
|
|
plString plConfigInfo::GetValue(const plString & section, const plString & key, const plString & defval, bool * outFound) const |
|
{ |
|
return fSections[section].GetValue(key,defval,outFound); |
|
} |
|
|
|
int plConfigInfo::GetValue(const plString & section, const plString & key, int defval, bool * outFound) const |
|
{ |
|
return fSections[section].GetValue(key,defval,outFound); |
|
} |
|
|
|
double plConfigInfo::GetValue(const plString & section, const plString & key, double defval, bool * outFound) const |
|
{ |
|
return fSections[section].GetValue(key,defval,outFound); |
|
} |
|
|
|
std::vector<plString> plConfigInfo::GetAllValues(const plString & section, const plString & key) const |
|
{ |
|
Sections::iterator si = fSections.find(section); |
|
if (si != fSections.end()) |
|
return si->second.GetAllValues(key); |
|
return std::vector<plString>(); |
|
} |
|
|
|
|
|
plString plConfigInfo::GetValueAny(const plString & key, const plString & defval, bool * outFound) const |
|
{ |
|
if (outFound) *outFound=false; |
|
for (Sections::iterator si=fSections.begin(); si!=fSections.end(); ++si) |
|
if (si->second.HasKey(key)) |
|
return si->second.GetValue(key,defval,outFound); |
|
return defval; |
|
} |
|
|
|
int plConfigInfo::GetValueAny(const plString & key, int defval, bool * outFound) const |
|
{ |
|
if (outFound) *outFound=false; |
|
for (Sections::iterator si=fSections.begin(); si!=fSections.end(); ++si) |
|
if (si->second.HasKey(key)) |
|
return si->second.GetValue(key,defval,outFound); |
|
return defval; |
|
} |
|
|
|
double plConfigInfo::GetValueAny(const plString & key, double defval, bool * outFound) const |
|
{ |
|
if (outFound) *outFound=false; |
|
for (Sections::iterator si=fSections.begin(); si!=fSections.end(); ++si) |
|
if (si->second.HasKey(key)) |
|
return si->second.GetValue(key,defval,outFound); |
|
return defval; |
|
} |
|
|
|
std::vector<plString> plConfigInfo::GetAllValuesAny(const plString & key) const |
|
{ |
|
for (Sections::iterator si=fSections.begin(); si!=fSections.end(); ++si) |
|
if (si->second.HasKey(key)) |
|
return si->second.GetAllValues(key); |
|
return std::vector<plString>(); |
|
} |
|
|
|
|
|
plString plConfigInfo::GetValueIn(const plString & key, const plString & defval, bool * outFound, const char * section1, ...) const |
|
{ |
|
if (outFound) *outFound=false; |
|
const char * section = section1; |
|
va_list sections; |
|
va_start(sections,section1); |
|
while (section) |
|
{ |
|
if (HasSection(section)) |
|
{ |
|
plKeysAndValues & kv = fSections[section]; |
|
if (kv.HasKey(key)) |
|
return kv.GetValue(key,defval,outFound); |
|
} |
|
section = va_arg(sections,const char *); |
|
} |
|
va_end(sections); |
|
return defval; |
|
} |
|
|
|
plString plConfigInfo::GetValueIn(const plString & key, const plString & defval, bool * outFound, const std::vector<plString> & sections ) const |
|
{ |
|
if (outFound) *outFound=false; |
|
for ( int i=0; i<sections.size(); i++ ) |
|
{ |
|
if (HasSection(sections[i])) |
|
{ |
|
plKeysAndValues & kv = fSections[sections[i]]; |
|
if (kv.HasKey(key)) |
|
return kv.GetValue(key,defval,outFound); |
|
} |
|
} |
|
return defval; |
|
} |
|
|
|
int plConfigInfo::GetValueIn(const plString & key, int defval, bool * outFound, const char * section1, ...) const |
|
{ |
|
if (outFound) *outFound=false; |
|
const char * section = section1; |
|
va_list sections; |
|
va_start(sections,section1); |
|
while (section) |
|
{ |
|
if (HasSection(section)) |
|
{ |
|
plKeysAndValues & kv = fSections[section]; |
|
if (kv.HasKey(key)) |
|
return kv.GetValue(key,defval,outFound); |
|
} |
|
section = va_arg(sections,const char *); |
|
} |
|
va_end(sections); |
|
return defval; |
|
} |
|
|
|
int plConfigInfo::GetValueIn(const plString & key, int defval, bool * outFound, const std::vector<plString> & sections ) const |
|
{ |
|
if (outFound) *outFound=false; |
|
for ( int i=0; i<sections.size(); i++ ) |
|
{ |
|
if (HasSection(sections[i])) |
|
{ |
|
plKeysAndValues & kv = fSections[sections[i]]; |
|
if (kv.HasKey(key)) |
|
return kv.GetValue(key,defval,outFound); |
|
} |
|
} |
|
return defval; |
|
} |
|
|
|
double plConfigInfo::GetValueIn(const plString & key, double defval, bool * outFound, const char * section1, ...) const |
|
{ |
|
if (outFound) *outFound=false; |
|
const char * section = section1; |
|
va_list sections; |
|
va_start(sections,section1); |
|
while (section) |
|
{ |
|
if (HasSection(section)) |
|
{ |
|
plKeysAndValues & kv = fSections[section]; |
|
if (kv.HasKey(key)) |
|
return kv.GetValue(key,defval,outFound); |
|
} |
|
section = va_arg(sections,const char *); |
|
} |
|
va_end(sections); |
|
return defval; |
|
} |
|
|
|
double plConfigInfo::GetValueIn(const plString & key, double defval, bool * outFound, const std::vector<plString> & sections ) const |
|
{ |
|
if (outFound) *outFound=false; |
|
for ( int i=0; i<sections.size(); i++ ) |
|
{ |
|
if (HasSection(sections[i])) |
|
{ |
|
plKeysAndValues & kv = fSections[sections[i]]; |
|
if (kv.HasKey(key)) |
|
return kv.GetValue(key,defval,outFound); |
|
} |
|
} |
|
return defval; |
|
} |
|
|
|
std::vector<plString> plConfigInfo::GetAllValuesIn(const plString & key, const char * section1, ...) |
|
{ |
|
const char * section = section1; |
|
va_list sections; |
|
va_start(sections,section1); |
|
std::vector<plString> result; |
|
while (section) |
|
{ |
|
if (HasSection(section)) |
|
{ |
|
plKeysAndValues & kv = fSections[section]; |
|
if (kv.HasKey(key)) |
|
{ |
|
std::vector<plString> values = kv.GetAllValues(key); |
|
result.insert(result.end(),values.begin(),values.end()); |
|
} |
|
} |
|
section = va_arg(sections,const char *); |
|
} |
|
va_end(sections); |
|
return result; |
|
} |
|
|
|
bool plConfigInfo::GetSectionIterators(Sections::const_iterator & iter, Sections::const_iterator & end) const |
|
{ |
|
iter = fSections.begin(); |
|
end = fSections.end(); |
|
return true; |
|
} |
|
|
|
bool plConfigInfo::GetKeyIterators(const plString & section, Keys::const_iterator & iter, Keys::const_iterator & end) const |
|
{ |
|
Sections::const_iterator si = fSections.find(section); |
|
if (si==fSections.end()) |
|
return false; |
|
return fSections[section].GetKeyIterators(iter, end); |
|
} |
|
|
|
bool plConfigInfo::GetValueIterators(const plString & section, const plString & key, Values::const_iterator & iter, Values::const_iterator & end) const |
|
{ |
|
Sections::const_iterator si = fSections.find(section); |
|
if (si==fSections.end()) |
|
return false; |
|
return fSections[section].GetValueIterators(key, iter, end); |
|
} |
|
|
|
bool plConfigInfo::ReadFrom(plConfigSource * src, KAddValueMode mode) |
|
{ |
|
return src->ReadInto(*this,mode); |
|
} |
|
|
|
bool plConfigInfo::WriteTo(plConfigSource * src) |
|
{ |
|
return src->WriteOutOf(*this); |
|
} |
|
|
|
|
|
//////////////////////////////////////////////// |
|
|
|
void plConfigSource::SplitAt(plString & key, plString & value, char splitter, plString & in) |
|
{ |
|
if (in.IsEmpty()) |
|
return; |
|
|
|
int t = in.Find(splitter); |
|
if (t < 0) |
|
{ |
|
key = in; |
|
return; |
|
} |
|
|
|
key = in.Left(t); |
|
value = in.Substr(t+1,in.GetSize()-t-1); |
|
} |
|
|
|
|
|
bool plConfigSource::ReadString(const plString & in) |
|
{ |
|
plString work = in.Trim(); |
|
|
|
// comment |
|
if (work.CharAt(0) == '#') |
|
return true; |
|
|
|
// comment |
|
if (work.CharAt(0) == ';') |
|
return true; |
|
|
|
// section |
|
if (work.CharAt(0) == '[') |
|
{ |
|
int close = work.Find("]"); |
|
if (close < 0) |
|
return false; |
|
fCurrSection = work.Substr(1, close-1); |
|
fEffectiveSection = fCurrSection; |
|
return true; |
|
} |
|
|
|
// key=value |
|
plString key, value; |
|
SplitAt(key, value, '=', work); |
|
|
|
// dot notation makes section change for this key=value only. |
|
int t = key.Find('.'); |
|
if (t>0 && t<key.GetSize()-1) |
|
{ |
|
fEffectiveSection = key.Left(t); |
|
key = key.Substr(t+1); |
|
} |
|
|
|
bool ret=ReadPair(key, value); |
|
fEffectiveSection = fCurrSection; |
|
|
|
if(ret && key.Compare("LoadIni") == 0) |
|
{ |
|
ret = ReadSubSource( value.c_str() ); |
|
} |
|
|
|
return ret; |
|
} |
|
|
|
bool plConfigSource::ReadPair(plString & key, plString & value) |
|
{ |
|
hsAssert(fConfigInfo, "plConfigSource::ProcessPair: fConfigInfo not set."); |
|
|
|
key = key.Trim(); |
|
value = value.Trim().Trim("\"'"); |
|
|
|
if (key.IsEmpty()) |
|
return true; |
|
|
|
return fConfigInfo->AddValue(fEffectiveSection, key, value, fAddMode); |
|
} |
|
|
|
|
|
bool plConfigSource::ReadList(char ** l) |
|
{ |
|
while(*l != NULL) |
|
{ |
|
ReadString(*l); |
|
l++; |
|
} |
|
return true; |
|
} |
|
|
|
|
|
bool plConfigSource::ReadInto(plConfigInfo & configInfo, KAddValueMode mode) |
|
{ |
|
fConfigInfo = &configInfo; |
|
fAddMode = mode; |
|
return true; |
|
} |
|
|
|
|
|
bool plConfigSource::WriteOutOf(plConfigInfo & configInfo) |
|
{ |
|
fConfigInfo = &configInfo; |
|
return true; |
|
} |
|
|
|
|
|
///////////////////////////////////////////////// |
|
|
|
plCmdLineConfigSource::plCmdLineConfigSource(int argc, char ** argv, const char * mySection) |
|
: fArgc(argc) |
|
, fArgv(argv) |
|
, fMySection(mySection) |
|
{} |
|
|
|
|
|
bool plCmdLineConfigSource::ReadInto(plConfigInfo & configInfo, KAddValueMode mode) |
|
{ |
|
int argc = fArgc; |
|
char ** argv = fArgv; |
|
|
|
if (!plConfigSource::ReadInto(configInfo, mode)) |
|
return false; |
|
|
|
fCurrSection = fMySection; |
|
fEffectiveSection = fCurrSection; |
|
|
|
if(argc < 1) |
|
return true; |
|
|
|
fConfigInfo->AddValue(fEffectiveSection, "ARGV0", *argv, fAddMode); |
|
argc--; |
|
argv++; |
|
|
|
while(argc > 0) |
|
{ |
|
if(ReadString(*argv) != true) |
|
{ |
|
// TODO: log error here |
|
return false; |
|
} |
|
argv++; |
|
argc--; |
|
} |
|
|
|
return true; |
|
} |
|
|
|
///////////////////////////////////////////////// |
|
|
|
plEnvConfigSource::plEnvConfigSource(char ** envp, const char * mySection) |
|
: fEnvp(envp) |
|
, fMySection(mySection) |
|
{} |
|
|
|
|
|
bool plEnvConfigSource::ReadInto(plConfigInfo & configInfo, KAddValueMode mode) |
|
{ |
|
if (!plConfigSource::ReadInto(configInfo, mode)) |
|
return false; |
|
|
|
if (fEnvp != NULL) |
|
{ |
|
fCurrSection = fMySection; |
|
fEffectiveSection = fCurrSection; |
|
return ReadList(fEnvp); |
|
} |
|
|
|
return true; |
|
} |
|
|
|
|
|
///////////////////////////////////////////////// |
|
|
|
plIniConfigSource::plIniConfigSource(const char * iniFileName) |
|
: fFileName(iniFileName) |
|
{} |
|
|
|
|
|
bool plIniConfigSource::ReadInto(plConfigInfo & configInfo, KAddValueMode mode) |
|
{ |
|
if (!plConfigSource::ReadInto(configInfo, mode)) |
|
return false; |
|
|
|
fCurrSection = plConfigInfo::GlobalSection(); |
|
fEffectiveSection = fCurrSection; |
|
|
|
if(fFileName.GetSize() < 2) |
|
return false; |
|
|
|
|
|
std::ifstream file; |
|
file.open(fFileName.c_str()); |
|
|
|
if(!file.is_open()) |
|
{ |
|
// TODO log error here |
|
return false; |
|
} |
|
|
|
char buf[4096]; |
|
|
|
while (!file.eof()) |
|
{ |
|
file.getline(buf, 4096); |
|
|
|
if(!ReadString(buf)) |
|
{ |
|
// TODO log warning here |
|
} |
|
} |
|
file.close(); |
|
|
|
return true; |
|
} |
|
|
|
bool plIniConfigSource::WriteOutOf(plConfigInfo & configInfo) |
|
{ |
|
if (!plConfigSource::WriteOutOf(configInfo)) |
|
return false; |
|
|
|
std::ofstream file; |
|
file.open(fFileName.c_str()); |
|
|
|
if(!file.is_open()) |
|
{ |
|
// TODO log error here |
|
return false; |
|
} |
|
|
|
file |
|
<< "# This is an auto-generated file." << std::endl |
|
<< std::endl |
|
; |
|
|
|
plConfigInfo::Sections::const_iterator si, se; |
|
plConfigInfo::Keys::const_iterator ki, ke; |
|
plConfigInfo::Values::const_iterator vi, ve; |
|
|
|
fConfigInfo->GetSectionIterators(si,se); |
|
for (; si!=se; ++si) |
|
{ |
|
file << std::endl << "[" << si->first.c_str() << "]"<< std::endl; |
|
if (fConfigInfo->GetKeyIterators(si->first, ki, ke)) |
|
for (; ki!=ke; ++ki) |
|
{ |
|
if (fConfigInfo->GetValueIterators(si->first, ki->first, vi, ve)) |
|
for (; vi!=ve; ++vi) |
|
{ |
|
file << ki->first.c_str() << "=" << vi->c_str() << std::endl; |
|
} |
|
} |
|
} |
|
|
|
file.close(); |
|
|
|
return true; |
|
} |
|
|
|
|
|
///////////////////////////////////////////////// |
|
|
|
plIniStreamConfigSource::plIniStreamConfigSource(hsStream * stream) |
|
: fStream(stream) |
|
{} |
|
|
|
|
|
bool plIniStreamConfigSource::ReadInto(plConfigInfo & configInfo, KAddValueMode mode) |
|
{ |
|
if (!plConfigSource::ReadInto(configInfo, mode)) |
|
return false; |
|
|
|
fCurrSection = "global"; |
|
fEffectiveSection = fCurrSection; |
|
|
|
if ( !fStream ) |
|
return false; |
|
|
|
char buf[4096]; |
|
|
|
while (!fStream->AtEnd()) |
|
{ |
|
fStream->ReadLn( buf, sizeof(buf) ); |
|
|
|
if(!ReadString(buf)) |
|
{ |
|
// TODO log warning here |
|
} |
|
} |
|
|
|
return true; |
|
} |
|
|
|
bool plIniStreamConfigSource::WriteOutOf(plConfigInfo & configInfo) |
|
{ |
|
if (!plConfigSource::WriteOutOf(configInfo)) |
|
return false; |
|
|
|
if ( !fStream ) |
|
return false; |
|
|
|
std::stringstream ss; |
|
|
|
plConfigInfo::Sections::const_iterator si, se; |
|
plConfigInfo::Keys::const_iterator ki, ke; |
|
plConfigInfo::Values::const_iterator vi, ve; |
|
|
|
fConfigInfo->GetSectionIterators(si,se); |
|
for (; si!=se; ++si) |
|
{ |
|
ss << std::endl << "[" << si->first.c_str() << "]"<< std::endl; |
|
if (fConfigInfo->GetKeyIterators(si->first, ki, ke)) |
|
for (; ki!=ke; ++ki) |
|
{ |
|
if (fConfigInfo->GetValueIterators(si->first, ki->first, vi, ve)) |
|
for (; vi!=ve; ++vi) |
|
{ |
|
ss << ki->first.c_str() << "=" << vi->c_str() << std::endl; |
|
} |
|
} |
|
} |
|
|
|
fStream->WriteString( ss.str().c_str() ); |
|
|
|
return true; |
|
} |
|
|
|
|
|
///////////////////////////////////////////////// |
|
|
|
plIniSectionConfigSource::plIniSectionConfigSource(const char * iniFileName, std::vector<plString> & sections) |
|
: plIniConfigSource(iniFileName) |
|
{ |
|
for (int i=0; i<sections.size(); i++) |
|
fSections.push_back(sections[i]); |
|
} |
|
|
|
|
|
bool plIniSectionConfigSource::ReadPair(plString & key, plString & value) |
|
{ |
|
hsAssert(fConfigInfo, "plConfigSource::ProcessPair: fConfigInfo not set."); |
|
|
|
// the current section must be in list of sections. |
|
Sections::iterator ii = std::find_if(fSections.begin(), fSections.end(), |
|
[this](const plString &v) { return v.CompareI(fCurrSection) == 0; } |
|
); |
|
|
|
if (ii==fSections.end()) |
|
return true; |
|
|
|
key = key.Trim(); |
|
value = value.Trim().Trim("\"'"); |
|
|
|
if (key.IsEmpty()) |
|
return true; |
|
|
|
if (key.CompareI("section") == 0) |
|
fSections.push_back(value); |
|
|
|
return fConfigInfo->AddValue(fEffectiveSection, key, value, fAddMode); |
|
} |
|
|
|
|
|
bool plIniSectionConfigSource::ReadSubSource( const char * name ) |
|
{ |
|
plIniSectionConfigSource src(name, fSections); |
|
return fConfigInfo->ReadFrom(&src); |
|
} |
|
|
|
///////////////////////////////////////////////// |
|
|
|
plIniNoSectionsConfigSource::plIniNoSectionsConfigSource(const char * filename) |
|
: fFileName(filename) |
|
{ |
|
fEffectiveSection = fCurrSection = ""; |
|
} |
|
|
|
bool plIniNoSectionsConfigSource::ReadString(const plString & in) |
|
{ |
|
plString work = in.Trim(); |
|
|
|
// ignore comments |
|
if (work.CharAt(0)=='#' || work.CharAt(0)==';') |
|
return true; |
|
|
|
// ignore sections |
|
if (work.CharAt(0) == '[') |
|
return true; |
|
|
|
// parse key value |
|
plString key, value; |
|
SplitAt(key, value, '=', work); |
|
|
|
return ReadPair(key, value); |
|
} |
|
|
|
bool plIniNoSectionsConfigSource::ReadInto(plConfigInfo & configInfo, KAddValueMode mode) |
|
{ |
|
if (!plConfigSource::ReadInto(configInfo, mode)) |
|
return false; |
|
|
|
if (fFileName.GetSize() < 2) |
|
return false; |
|
|
|
std::ifstream file; |
|
file.open(fFileName.c_str()); |
|
|
|
if(!file.is_open()) |
|
{ |
|
// TODO log error here |
|
return false; |
|
} |
|
|
|
char buf[4096]; |
|
|
|
while (!file.eof()) |
|
{ |
|
file.getline(buf, 4096); |
|
|
|
if(!ReadString(buf)) |
|
{ |
|
// TODO log warning here |
|
} |
|
} |
|
file.close(); |
|
|
|
return true; |
|
} |
|
|
|
|
|
bool plIniNoSectionsConfigSource::WriteOutOf(plConfigInfo & configInfo) |
|
{ |
|
if (!plConfigSource::WriteOutOf(configInfo)) |
|
return false; |
|
|
|
std::ofstream file; |
|
file.open(fFileName.c_str()); |
|
|
|
if(!file.is_open()) |
|
{ |
|
// TODO log error here |
|
return false; |
|
} |
|
|
|
file |
|
<< "# This is an auto-generated file." << std::endl |
|
<< std::endl |
|
; |
|
|
|
plConfigInfo::Sections::const_iterator si, se; |
|
plConfigInfo::Keys::const_iterator ki, ke; |
|
plConfigInfo::Values::const_iterator vi, ve; |
|
|
|
fConfigInfo->GetSectionIterators(si,se); |
|
for (; si!=se; ++si) |
|
{ |
|
if (fConfigInfo->GetKeyIterators(si->first, ki, ke)) |
|
for (; ki!=ke; ++ki) |
|
{ |
|
if (fConfigInfo->GetValueIterators(si->first, ki->first, vi, ve)) |
|
for (; vi!=ve; ++vi) |
|
{ |
|
file << ki->first.c_str() << "=" << vi->c_str() << std::endl; |
|
} |
|
} |
|
} |
|
|
|
file.close(); |
|
|
|
return true; |
|
} |
|
|
|
|
|
///////////////////////////////////////////////// |
|
|
|
bool plDebugConfigSource::WriteOutOf(plConfigInfo & configInfo) |
|
{ |
|
if (!plConfigSource::WriteOutOf(configInfo)) |
|
return false; |
|
|
|
plConfigInfo::Sections::const_iterator si, se; |
|
plConfigInfo::Keys::const_iterator ki, ke; |
|
plConfigInfo::Values::const_iterator vi, ve; |
|
|
|
char buf[1024]; |
|
fConfigInfo->GetSectionIterators(si,se); |
|
for (; si!=se; ++si) |
|
{ |
|
sprintf(buf,"\n[%s]\n",si->first.c_str()); |
|
hsStatusMessage(buf); |
|
if (fConfigInfo->GetKeyIterators(si->first, ki, ke)) |
|
for (; ki!=ke; ++ki) |
|
{ |
|
if (fConfigInfo->GetValueIterators(si->first, ki->first, vi, ve)) |
|
for (; vi!=ve; ++vi) |
|
{ |
|
sprintf(buf,"%s=%s\n",ki->first.c_str(),vi->c_str()); |
|
hsStatusMessage(buf); |
|
} |
|
} |
|
} |
|
|
|
return true; |
|
} |
|
|
|
//////////////////////////////////////////////////////////////////// |
|
|
|
void plConfigValueBase::ConfigRead(plConfigInfo * opts) |
|
{ |
|
if (fReadEvaluate()) |
|
{ |
|
plString value; |
|
bool found; |
|
value = opts->GetValue(GetConfigGroup(),GetConfigName(),"",&found); |
|
if (found) |
|
SetValue(fReadModify(value)); |
|
} |
|
} |
|
|
|
void plConfigValueBase::ConfigWrite(plConfigInfo * opts) |
|
{ |
|
if (fWriteEvaluate()) |
|
{ |
|
opts->AddValue(GetConfigGroup(),GetConfigName(),fWriteModify(GetValue()),kAlwaysAdd); |
|
} |
|
} |
|
|
|
void plConfigValueBase::SetValue(const plString & value) |
|
{ |
|
ISetValue(fSetModify(value)); |
|
} |
|
|
|
plString plConfigValueBase::GetValue() const |
|
{ |
|
return fGetModify(IGetValue()); |
|
} |
|
|
|
void plConfigValueBase::SetReadEvaluate(plClass * targetObj, TEvaluate evalFunc) |
|
{ |
|
fReadEvaluate = plEvaluate(targetObj,evalFunc); |
|
} |
|
|
|
void plConfigValueBase::SetWriteEvaluate(plClass * targetObj, TEvaluate evalFunc) |
|
{ |
|
fWriteEvaluate = plEvaluate(targetObj,evalFunc); |
|
} |
|
|
|
void plConfigValueBase::SetWriteEvaluate(plClass * targetObj, TEvaluateConst evalFunc) |
|
{ |
|
fWriteEvaluate = plEvaluate(targetObj,evalFunc); |
|
} |
|
|
|
void plConfigValueBase::SetReadModify(plClass * targetObj, TModify modifyFunc) |
|
{ |
|
fReadModify = plModify(targetObj,modifyFunc); |
|
} |
|
|
|
void plConfigValueBase::SetWriteModify(plClass * targetObj, TModify modifyFunc) |
|
{ |
|
fWriteModify = plModify(targetObj,modifyFunc); |
|
} |
|
|
|
void plConfigValueBase::SetGetModify(plClass * targetObj, TModify modifyFunc) |
|
{ |
|
fGetModify = plModify(targetObj,modifyFunc); |
|
} |
|
|
|
void plConfigValueBase::SetSetModify(plClass * targetObj, TModify modifyFunc) |
|
{ |
|
fSetModify = plModify(targetObj,modifyFunc); |
|
} |
|
|
|
|
|
//////////////////////////////////////////////////////////////////// |
|
|
|
plConfigGroup::plConfigGroup(const char * groupName) |
|
: fGroupName(groupName) |
|
{} |
|
|
|
bool plConfigGroup::Read(plConfigSource * src) |
|
{ |
|
if (!fOpts.ReadFrom(src)) |
|
return false; |
|
for (int i=0; i<fItems.size(); i++) |
|
fItems[i]->ConfigRead(&fOpts); |
|
return true; |
|
} |
|
|
|
bool plConfigGroup::Write(plConfigSource * src) |
|
{ |
|
for (int i=0; i<fItems.size(); i++) |
|
fItems[i]->ConfigWrite(&fOpts); |
|
return fOpts.WriteTo(src); |
|
} |
|
|
|
void plConfigGroup::AddItem(plConfigValueBase * item, const char * name) |
|
{ |
|
item->SetConfigGroup(fGroupName); |
|
if (name) |
|
item->SetConfigName(name); |
|
fItems.push_back(item); |
|
} |
|
|
|
//////////////////////////////////////////////////////////////////// |
|
|
|
plConfigAggregateValue::plConfigAggregateValue( |
|
const char * name, |
|
plConfigValueBase * item1, |
|
plConfigValueBase * item2, |
|
plConfigValueBase * item3, |
|
plConfigValueBase * item4, |
|
plConfigValueBase * item5, |
|
plConfigValueBase * item6, |
|
plConfigValueBase * item7) |
|
{ |
|
SetConfigName(name); |
|
AddItems(item1,item2,item3,item4,item5,item6,item7); |
|
} |
|
|
|
void plConfigAggregateValue::AddItems( |
|
plConfigValueBase * item1, |
|
plConfigValueBase * item2, |
|
plConfigValueBase * item3, |
|
plConfigValueBase * item4, |
|
plConfigValueBase * item5, |
|
plConfigValueBase * item6, |
|
plConfigValueBase * item7) |
|
{ |
|
fItems.clear(); |
|
if (item1) AddItem(item1); |
|
if (item2) AddItem(item2); |
|
if (item3) AddItem(item3); |
|
if (item4) AddItem(item4); |
|
if (item5) AddItem(item5); |
|
if (item6) AddItem(item6); |
|
if (item7) AddItem(item7); |
|
} |
|
|
|
void plConfigAggregateValue::ISetValue(const plString & value) |
|
{ |
|
plString work = value.Trim(); |
|
int p=0,i=0; |
|
do |
|
{ |
|
p = work.Find(" "); |
|
fItems[i]->SetValue(work.Left(p)); |
|
work = work.Substr(p).TrimLeft(); |
|
i++; |
|
} while (i<fItems.size() && p>=0); |
|
} |
|
|
|
plString plConfigAggregateValue::IGetValue() const |
|
{ |
|
plStringStream value; |
|
for (int i=0; i<fItems.size(); i++) |
|
{ |
|
value << fItems[i]->GetValue(); |
|
value << ' '; |
|
} |
|
return value.GetString().Trim(); |
|
} |
|
|
|
void plConfigAggregateValue::AddItem(plConfigValueBase * item) |
|
{ |
|
fItems.push_back(item); |
|
} |
|
|
|
//////////////////////////////////////////////////////////////////// |
|
|
|
plWWWAuthenticateConfigSource::plWWWAuthenticateConfigSource(const plString& auth) |
|
: fAuth(auth) |
|
{ |
|
fEffectiveSection = fCurrSection = ""; |
|
} |
|
|
|
bool plWWWAuthenticateConfigSource::ReadInto(plConfigInfo & configInfo, KAddValueMode mode) |
|
{ |
|
if (!plConfigSource::ReadInto(configInfo, mode)) |
|
return false; |
|
|
|
fCurrSection = "global"; |
|
fEffectiveSection = fCurrSection; |
|
|
|
unsigned int i = 0; |
|
|
|
while (i < fAuth.GetSize()) |
|
{ |
|
bool inQuote = false; |
|
unsigned int begin = i,end; |
|
while (i < fAuth.GetSize() |
|
&& ((fAuth.CharAt(i) != ',' && !inQuote) || inQuote)) |
|
{ |
|
if (fAuth.CharAt(i) == '"') |
|
inQuote = ! inQuote; |
|
i++; |
|
} |
|
end = i; |
|
|
|
plString buf = fAuth.Substr(begin, end-begin); |
|
if (!ReadString(buf)) |
|
{ |
|
// TODO log warning here |
|
} |
|
i++; |
|
} |
|
|
|
return true; |
|
}
|
|
|